cas: 2198-59-6 — see every product listed under this CAS number, including other names
N1-Phenylbenzene-1,4-diamine hydrochloride, 97%, 97% (CAS 2198-59-6) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114KRC-5g |
| cas | 2198-59-6 |
| size | 5g |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 170.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-N-phenylbenzene-1,4-diamine;hydrochloride (CAS 2198-59-6) is a chemical compound with the molecular formula C12H13ClN2 and a molecular weight of 220.70 g/mol. IUPAC name: 4-N-phenylbenzene-1,4-diamine;hydrochloride. InChIKey: PNEVDCGZQWFIKV-UHFFFAOYSA-N.
| Molecular formula | C12H13ClN2 |
|---|---|
| Molecular weight | 220.70 g/mol |
| IUPAC name | 4-N-phenylbenzene-1,4-diamine;hydrochloride |
| InChIKey | PNEVDCGZQWFIKV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=CC=C(C=C2)N.Cl |
Computed by PubChem (NCBI)