cas: 3160-47-2 — see every product listed under this CAS number, including other names
Z-Asp(OMe)-OH, 97%, 97% (CAS 3160-47-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114VDC-1g |
| cas | 3160-47-2 |
| size | 1g |
| availability | 1500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 93.20 Pln | |
| Chemat | 10g | 122.00 Pln | |
| Chemat | 25g | 213.20 Pln | |
| Chemat | 100g | 467.60 Pln | |
| Chemat | 500g | 2150.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2S)-4-methoxy-4-oxo-2-(phenylmethoxycarbonylamino)butanoic acid (CAS 3160-47-2) is a chemical compound with the molecular formula C13H15NO6 and a molecular weight of 281.26 g/mol. IUPAC name: (2S)-4-methoxy-4-oxo-2-(phenylmethoxycarbonylamino)butanoic acid. InChIKey: PHMBNDDHIBIDRQ-JTQLQIEISA-N.
| Molecular formula | C13H15NO6 |
|---|---|
| Molecular weight | 281.26 g/mol |
| IUPAC name | (2S)-4-methoxy-4-oxo-2-(phenylmethoxycarbonylamino)butanoic acid |
| InChIKey | PHMBNDDHIBIDRQ-JTQLQIEISA-N |
| SMILES | COC(=O)C[C@@H](C(=O)O)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)