cas: 3160-47-2 — see every product listed under this CAS number, including other names
Z-Asp(OMe)-OH (CAS 3160-47-2) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 25mg, 100mg. Offered by: TargetMol.
| brand | TargetMol |
|---|---|
| catalog number | T65922-10mg |
| cas | 3160-47-2 |
| size | 10mg |
| brand | size | price | |
|---|---|---|---|
| TargetMol | 10mg | 432.54 Pln | |
| TargetMol | 25mg | 565.03 Pln | |
| TargetMol | 100mg | 817.70 Pln |
| purity | No data |
|---|---|
| delivery time | approx. 33 days |
(2S)-4-methoxy-4-oxo-2-(phenylmethoxycarbonylamino)butanoic acid (CAS 3160-47-2) is a chemical compound with the molecular formula C13H15NO6 and a molecular weight of 281.26 g/mol. IUPAC name: (2S)-4-methoxy-4-oxo-2-(phenylmethoxycarbonylamino)butanoic acid. InChIKey: PHMBNDDHIBIDRQ-JTQLQIEISA-N.
| Molecular formula | C13H15NO6 |
|---|---|
| Molecular weight | 281.26 g/mol |
| IUPAC name | (2S)-4-methoxy-4-oxo-2-(phenylmethoxycarbonylamino)butanoic acid |
| InChIKey | PHMBNDDHIBIDRQ-JTQLQIEISA-N |
| SMILES | COC(=O)C[C@@H](C(=O)O)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)