cas: 3160-47-2 — see every product listed under this CAS number, including other names
Z-Asp(OMe)-OH, 99.71% (CAS 3160-47-2) is a chemical reagent available from Chemat. Available pack sizes: 10 g, 25 g, 100 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W011553-10 g |
| cas | 3160-47-2 |
| size | 10 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 10 g | 240.74 Pln | |
| MedChemExpress | 25 g | 370.78 Pln | |
| MedChemExpress | 100 g | 589.04 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 99.71% |
(2S)-4-methoxy-4-oxo-2-(phenylmethoxycarbonylamino)butanoic acid (CAS 3160-47-2) is a chemical compound with the molecular formula C13H15NO6 and a molecular weight of 281.26 g/mol. IUPAC name: (2S)-4-methoxy-4-oxo-2-(phenylmethoxycarbonylamino)butanoic acid. InChIKey: PHMBNDDHIBIDRQ-JTQLQIEISA-N.
| Molecular formula | C13H15NO6 |
|---|---|
| Molecular weight | 281.26 g/mol |
| IUPAC name | (2S)-4-methoxy-4-oxo-2-(phenylmethoxycarbonylamino)butanoic acid |
| InChIKey | PHMBNDDHIBIDRQ-JTQLQIEISA-N |
| SMILES | COC(=O)C[C@@H](C(=O)O)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)