cas: 3160-47-2 — see every product listed under this CAS number, including other names
(S)-2-N-Cbz-amino-succinic acid 4-methyl ester, 97% (CAS 3160-47-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F041111-1G |
| cas | 3160-47-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 10g | 174.96 Pln | |
| Fluorochem | 25g | 253.05 Pln | |
| Fluorochem | 100g | 570.65 Pln | |
| Fluorochem | 500g | 2601.19 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
(2S)-4-methoxy-4-oxo-2-(phenylmethoxycarbonylamino)butanoic acid (CAS 3160-47-2) is a chemical compound with the molecular formula C13H15NO6 and a molecular weight of 281.26 g/mol. IUPAC name: (2S)-4-methoxy-4-oxo-2-(phenylmethoxycarbonylamino)butanoic acid. InChIKey: PHMBNDDHIBIDRQ-JTQLQIEISA-N.
| Molecular formula | C13H15NO6 |
|---|---|
| Molecular weight | 281.26 g/mol |
| IUPAC name | (2S)-4-methoxy-4-oxo-2-(phenylmethoxycarbonylamino)butanoic acid |
| InChIKey | PHMBNDDHIBIDRQ-JTQLQIEISA-N |
| SMILES | COC(=O)C[C@@H](C(=O)O)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)