endo-BCN-NHS carbonate 97%
cas: 1426827-79-3 — see every product listed under this CAS number, including other names
endo-BCN-NHS carbonate 97% (CAS 1426827-79-3) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1003284-50mg |
| cas | 1426827-79-3 |
| size | 50mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 242.44 Pln | |
| Ambeed | 100mg | 398.19 Pln | |
| Ambeed | 250mg | 782.00 Pln | |
| Ambeed | 1g | 1638.62 Pln | |
| Ambeed | 5g | 6027.44 Pln | |
| Ambeed | 10g | 10243.81 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1003284 |
[(1S,8R)-9-bicyclo[6.1.0]non-4-ynyl]methyl (2,5-dioxopyrrolidin-1-yl) carbonate (CAS 1426827-79-3) is a chemical compound with the molecular formula C15H17NO5 and a molecular weight of 291.30 g/mol. IUPAC name: [(1S,8R)-9-bicyclo[6.1.0]non-4-ynyl]methyl (2,5-dioxopyrrolidin-1-yl) carbonate. InChIKey: SKTDJYHCSCYLQU-FOSCPWQOSA-N.
| Molecular formula | C15H17NO5 |
|---|---|
| Molecular weight | 291.30 g/mol |
| IUPAC name | [(1S,8R)-9-bicyclo[6.1.0]non-4-ynyl]methyl (2,5-dioxopyrrolidin-1-yl) carbonate |
| InChIKey | SKTDJYHCSCYLQU-FOSCPWQOSA-N |
| SMILES | C1C[C@@H]2[C@@H](C2COC(=O)ON3C(=O)CCC3=O)CCC#C1 |
Computed by PubChem (NCBI)
Synonyms:
endo-BCN-NHS carbonate, exo-BCN-NHS carbonate, (1R,8S,9s)-Bicyclo[6.1.0]non-4-yn-9-ylmethyl Succinimidyl Carbonate, BCN-NHS, [(1S,8R)-9-bicyclo[6.1.0]non-4-ynyl]methyl (2,5-dioxopyrrolidin-1-yl) carbonate, (1R,8S,9s)-Bicyclo[6.1.0]non-4-yn-9-ylmethyl N-succinimidyl carbonate, endo-BCN-OSu, exo-BCN-OSu, BCN-CO-NHS, (1R,8S,9s)-bicyclo[6.1.0]non-4-yn-9-ylmethylN-succinimide carbonate