CAS 1004192-86-2 appears in our catalog under these names: 1–((3,5–Dimethyl–1H–pyrazol–1–yl)methyl)–1H–pyrazole–3–carboxylic acid, 1-(3,5-Dimethyl-pyrazol-1-ylmethyl)-1 H -pyrazole-3-carboxylic acid, 1-((3,5-Dimethyl-1H-pyrazol-1-yl)methyl)-1H-pyrazole-3-carboxylic acid, 97%, 97%, 1-(3,5-Dimethyl-pyrazol-1-ylmethyl)-1 H -pyrazole-3-carboxylic acid, 97%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 5g, 0,5g, 250mg, 1g.
1-[(3,5-dimethylpyrazol-1-yl)methyl]pyrazole-3-carboxylic acid (CAS 1004192-86-2) is a chemical compound with the molecular formula C10H12N4O2 and a molecular weight of 220.23 g/mol. IUPAC name: 1-[(3,5-dimethylpyrazol-1-yl)methyl]pyrazole-3-carboxylic acid. InChIKey: QRXKQVJOVFCIDQ-UHFFFAOYSA-N.
| Molecular formula | C10H12N4O2 |
|---|---|
| Molecular weight | 220.23 g/mol |
| IUPAC name | 1-[(3,5-dimethylpyrazol-1-yl)methyl]pyrazole-3-carboxylic acid |
| InChIKey | QRXKQVJOVFCIDQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1CN2C=CC(=N2)C(=O)O)C |
Computed by PubChem (NCBI)