Products 102082-89-3
CAS 102082-89-3 appears in our catalog under these names: (E)-3-(2,6-Difluorophenyl)acrylic acid 98%, trans–2,6–Difluorocinnamic Acid, trans-2,6-Difluorocinnamic Acid, >95.0%(GC)(T), trans-2,6-Difluorocinnamic Acid, 98%, 98%, trans-2,6-Difluorocinnamic acid, 98%. Offered by: Ambeed, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g, 100g, 10g.
(E)-3-(2,6-difluorophenyl)prop-2-enoic acid (CAS 102082-89-3) is a chemical compound with the molecular formula C9H6F2O2 and a molecular weight of 184.14 g/mol. IUPAC name: (E)-3-(2,6-difluorophenyl)prop-2-enoic acid. InChIKey: JMUOYANNVIFGFN-SNAWJCMRSA-N.
| Molecular formula | C9H6F2O2 |
|---|---|
| Molecular weight | 184.14 g/mol |
| IUPAC name | (E)-3-(2,6-difluorophenyl)prop-2-enoic acid |
| InChIKey | JMUOYANNVIFGFN-SNAWJCMRSA-N |
| SMILES | C1=CC(=C(C(=C1)F)/C=C/C(=O)O)F |
Computed by PubChem (NCBI)
Synonyms:
2,6-Difluorocinnamic acid, 3-(2,6-difluorophenyl)prop-2-enoic acid, trans-2,6-Difluorocinnamic acid, (E)-3-(2,6-difluorophenyl)acrylic acid, (E)-3-(2,6-difluorophenyl)prop-2-enoic acid, 3-(2,6-difluorophenyl)acrylic acid, 2-Propenoic acid, 3-(2,6-difluorophenyl)-, (2E)-, (2E)-3-(2,6-difluorophenyl)prop-2-enoic acid, 2,6-Difluorocinnamicacid, 2,6-Difluorocinnamic Acid, Predominantly trans