Products 152152-09-5
CAS 152152-09-5 appears in our catalog under these names: 2,6-Difluorocinnamic acid, 98%, 98%, 3-(2,6-Difluorophenyl)acrylic acid, 98%, 2,6-Difluorocinnamic acid, 95% (E). Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g, 25g.
(E)-3-(2,6-difluorophenyl)prop-2-enoic acid (CAS 152152-09-5) is a chemical compound with the molecular formula C9H6F2O2 and a molecular weight of 184.14 g/mol. IUPAC name: (E)-3-(2,6-difluorophenyl)prop-2-enoic acid. InChIKey: JMUOYANNVIFGFN-SNAWJCMRSA-N.
| Molecular formula | C9H6F2O2 |
|---|---|
| Molecular weight | 184.14 g/mol |
| IUPAC name | (E)-3-(2,6-difluorophenyl)prop-2-enoic acid |
| InChIKey | JMUOYANNVIFGFN-SNAWJCMRSA-N |
| SMILES | C1=CC(=C(C(=C1)F)/C=C/C(=O)O)F |
Computed by PubChem (NCBI)
Synonyms:
2,6-Difluorocinnamic acid, 3-(2,6-difluorophenyl)prop-2-enoic acid, trans-2,6-Difluorocinnamic acid, (E)-3-(2,6-difluorophenyl)acrylic acid, (E)-3-(2,6-difluorophenyl)prop-2-enoic acid, 3-(2,6-difluorophenyl)acrylic acid, 2-Propenoic acid, 3-(2,6-difluorophenyl)-, (2E)-, (2E)-3-(2,6-difluorophenyl)prop-2-enoic acid, 2,6-Difluorocinnamicacid, 2,6-Difluorocinnamic Acid, Predominantly trans