CAS 1022362-21-5 is the registry number for 4-((((1,3-dioxoindan-2-ylidene)methyl)amino)methyl)benzoic acid. Offered by: Biosynth. Available pack sizes: 250mg.
4-[[(1-hydroxy-3-oxoinden-2-yl)methylideneamino]methyl]benzoic acid (CAS 1022362-21-5) is a chemical compound with the molecular formula C18H13NO4 and a molecular weight of 307.3 g/mol. IUPAC name: 4-[[(1-hydroxy-3-oxoinden-2-yl)methylideneamino]methyl]benzoic acid. InChIKey: BCBIEISMESHZHL-UHFFFAOYSA-N.
| Molecular formula | C18H13NO4 |
|---|---|
| Molecular weight | 307.3 g/mol |
| IUPAC name | 4-[[(1-hydroxy-3-oxoinden-2-yl)methylideneamino]methyl]benzoic acid |
| InChIKey | BCBIEISMESHZHL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(C2=O)C=NCC3=CC=C(C=C3)C(=O)O)O |
Computed by PubChem (NCBI)