CAS 1632-49-1 appears in our catalog under these names: Butamirate Impurity 7, 3,4-Diphenyl-1H-pyrrole-2,5-dicarboxylic Acid. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
3,4-diphenyl-1H-pyrrole-2,5-dicarboxylic acid (CAS 1632-49-1) is a chemical compound with the molecular formula C18H13NO4 and a molecular weight of 307.3 g/mol. IUPAC name: 3,4-diphenyl-1H-pyrrole-2,5-dicarboxylic acid. InChIKey: KEPFKTIMWQZVNN-UHFFFAOYSA-N.
| Molecular formula | C18H13NO4 |
|---|---|
| Molecular weight | 307.3 g/mol |
| IUPAC name | 3,4-diphenyl-1H-pyrrole-2,5-dicarboxylic acid |
| InChIKey | KEPFKTIMWQZVNN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(NC(=C2C3=CC=CC=C3)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)