CAS 51537-87-2 appears in our catalog under these names: 4-Nitrophenyl 2-(naphthalen-1-yl)acetate, 98%, 1-Naphthylacetic Acid 4-Nitrophenyl Ester. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 2,5g, 250mg.
(4-nitrophenyl) 2-naphthalen-1-ylacetate (CAS 51537-87-2) is a chemical compound with the molecular formula C18H13NO4 and a molecular weight of 307.3 g/mol. IUPAC name: (4-nitrophenyl) 2-naphthalen-1-ylacetate. InChIKey: ABJNXPMQKGUCPD-UHFFFAOYSA-N.
| Molecular formula | C18H13NO4 |
|---|---|
| Molecular weight | 307.3 g/mol |
| IUPAC name | (4-nitrophenyl) 2-naphthalen-1-ylacetate |
| InChIKey | ABJNXPMQKGUCPD-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2CC(=O)OC3=CC=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)