Products 1199215-62-7

CAS 1199215-62-7 is the registry number for 2-(4-Phenoxyphenoxy)isonicotinic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-(4-phenoxyphenoxy)pyridine-4-carboxylic acid (CAS 1199215-62-7) is a chemical compound with the molecular formula C18H13NO4 and a molecular weight of 307.3 g/mol. IUPAC name: 2-(4-phenoxyphenoxy)pyridine-4-carboxylic acid. InChIKey: ACQIQSZZTAQCPJ-UHFFFAOYSA-N.

Identity
Molecular formulaC18H13NO4
Molecular weight307.3 g/mol
IUPAC name2-(4-phenoxyphenoxy)pyridine-4-carboxylic acid
InChIKeyACQIQSZZTAQCPJ-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)OC2=CC=C(C=C2)OC3=NC=CC(=C3)C(=O)O

Computed by PubChem (NCBI)