CAS 1024232-32-3 is the registry number for 2-((benzo(3,4-d)1,3-dioxolen-5-ylamino)ethylidene)indane-1,3-dione. Offered by: Biosynth. Available pack sizes: 250mg.
2-[N-(1,3-benzodioxol-5-yl)-C-methylcarbonimidoyl]-3-hydroxyinden-1-one (CAS 1024232-32-3) is a chemical compound with the molecular formula C18H13NO4 and a molecular weight of 307.3 g/mol. IUPAC name: 2-[N-(1,3-benzodioxol-5-yl)-C-methylcarbonimidoyl]-3-hydroxyinden-1-one. InChIKey: SLRBPZRLUISBJW-UHFFFAOYSA-N.
| Molecular formula | C18H13NO4 |
|---|---|
| Molecular weight | 307.3 g/mol |
| IUPAC name | 2-[N-(1,3-benzodioxol-5-yl)-C-methylcarbonimidoyl]-3-hydroxyinden-1-one |
| InChIKey | SLRBPZRLUISBJW-UHFFFAOYSA-N |
| SMILES | CC(=NC1=CC2=C(C=C1)OCO2)C3=C(C4=CC=CC=C4C3=O)O |
Computed by PubChem (NCBI)