CAS 1872262-67-3 is the registry number for 1,3-Dioxoisoindolin-2-yl 2,3-dihydro-1H-indene-2-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1,3-dioxoisoindol-2-yl) 2,3-dihydro-1H-indene-2-carboxylate (CAS 1872262-67-3) is a chemical compound with the molecular formula C18H13NO4 and a molecular weight of 307.3 g/mol. IUPAC name: (1,3-dioxoisoindol-2-yl) 2,3-dihydro-1H-indene-2-carboxylate. InChIKey: QGWUHKAYZUZPBX-UHFFFAOYSA-N.
| Molecular formula | C18H13NO4 |
|---|---|
| Molecular weight | 307.3 g/mol |
| IUPAC name | (1,3-dioxoisoindol-2-yl) 2,3-dihydro-1H-indene-2-carboxylate |
| InChIKey | QGWUHKAYZUZPBX-UHFFFAOYSA-N |
| SMILES | C1C(CC2=CC=CC=C21)C(=O)ON3C(=O)C4=CC=CC=C4C3=O |
Computed by PubChem (NCBI)