CAS 1147564-13-3 is the registry number for 3-Methyl-1,4-dioxo-1,4-dihydronaphthalen-2-yl 4-aminobenzoate. Offered by: TRC. Available pack sizes: 250mg.
(3-methyl-1,4-dioxonaphthalen-2-yl) 4-aminobenzoate (CAS 1147564-13-3) is a chemical compound with the molecular formula C18H13NO4 and a molecular weight of 307.3 g/mol. IUPAC name: (3-methyl-1,4-dioxonaphthalen-2-yl) 4-aminobenzoate. InChIKey: LUHXTUQTLBVQIC-UHFFFAOYSA-N.
| Molecular formula | C18H13NO4 |
|---|---|
| Molecular weight | 307.3 g/mol |
| IUPAC name | (3-methyl-1,4-dioxonaphthalen-2-yl) 4-aminobenzoate |
| InChIKey | LUHXTUQTLBVQIC-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)C2=CC=CC=C2C1=O)OC(=O)C3=CC=C(C=C3)N |
Computed by PubChem (NCBI)