Products 1820642-15-6
CAS 1820642-15-6 is the registry number for methyl 3-(naphthalen-1-yl)-5-nitrobenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Methyl 3-naphthalen-1-yl-5-nitrobenzoate (CAS 1820642-15-6) is a chemical compound with the molecular formula C18H13NO4 and a molecular weight of 307.3 g/mol. IUPAC name: methyl 3-naphthalen-1-yl-5-nitrobenzoate. InChIKey: YVLIMYSFWRACKG-UHFFFAOYSA-N.
| Molecular formula | C18H13NO4 |
|---|---|
| Molecular weight | 307.3 g/mol |
| IUPAC name | methyl 3-naphthalen-1-yl-5-nitrobenzoate |
| InChIKey | YVLIMYSFWRACKG-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC(=C1)C2=CC=CC3=CC=CC=C32)[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
methyl 3-naphthalen-1-yl-5-nitrobenzoate