CAS 1024126-55-3 is the registry number for 2-(((1,3-dioxoindan-2-ylidene)methyl)amino)-6-methylbenzoic acid. Offered by: Biosynth. Available pack sizes: 250mg.
2-[(1-hydroxy-3-oxoinden-2-yl)methylideneamino]-6-methylbenzoic acid (CAS 1024126-55-3) is a chemical compound with the molecular formula C18H13NO4 and a molecular weight of 307.3 g/mol. IUPAC name: 2-[(1-hydroxy-3-oxoinden-2-yl)methylideneamino]-6-methylbenzoic acid. InChIKey: KSZMMITXOCMJBE-UHFFFAOYSA-N.
| Molecular formula | C18H13NO4 |
|---|---|
| Molecular weight | 307.3 g/mol |
| IUPAC name | 2-[(1-hydroxy-3-oxoinden-2-yl)methylideneamino]-6-methylbenzoic acid |
| InChIKey | KSZMMITXOCMJBE-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)N=CC2=C(C3=CC=CC=C3C2=O)O)C(=O)O |
Computed by PubChem (NCBI)