Products 302936-17-0

CAS 302936-17-0 is the registry number for 2-(2,3-Dihydro-1,4-benzodioxin-6-yl)quinoline-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-(2,3-dihydro-1,4-benzodioxin-6-yl)quinoline-4-carboxylic acid (CAS 302936-17-0) is a chemical compound with the molecular formula C18H13NO4 and a molecular weight of 307.3 g/mol. IUPAC name: 2-(2,3-dihydro-1,4-benzodioxin-6-yl)quinoline-4-carboxylic acid. InChIKey: ICBSLSGMOTUPAX-UHFFFAOYSA-N.

Identity
Molecular formulaC18H13NO4
Molecular weight307.3 g/mol
IUPAC name2-(2,3-dihydro-1,4-benzodioxin-6-yl)quinoline-4-carboxylic acid
InChIKeyICBSLSGMOTUPAX-UHFFFAOYSA-N
SMILESC1COC2=C(O1)C=CC(=C2)C3=NC4=CC=CC=C4C(=C3)C(=O)O

Computed by PubChem (NCBI)