CAS 302936-17-0 is the registry number for 2-(2,3-Dihydro-1,4-benzodioxin-6-yl)quinoline-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
2-(2,3-dihydro-1,4-benzodioxin-6-yl)quinoline-4-carboxylic acid (CAS 302936-17-0) is a chemical compound with the molecular formula C18H13NO4 and a molecular weight of 307.3 g/mol. IUPAC name: 2-(2,3-dihydro-1,4-benzodioxin-6-yl)quinoline-4-carboxylic acid. InChIKey: ICBSLSGMOTUPAX-UHFFFAOYSA-N.
| Molecular formula | C18H13NO4 |
|---|---|
| Molecular weight | 307.3 g/mol |
| IUPAC name | 2-(2,3-dihydro-1,4-benzodioxin-6-yl)quinoline-4-carboxylic acid |
| InChIKey | ICBSLSGMOTUPAX-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=CC(=C2)C3=NC4=CC=CC=C4C(=C3)C(=O)O |
Computed by PubChem (NCBI)