CAS 10241-98-2 appears in our catalog under these names: 5-Chloroindoline-2-carboxylic acid 95%, 5-Chloroindoline-2-carboxylic acid, 95%, 5-Chloroindoline-2-carboxylic acid, 95%, 95%. Offered by: Ambeed, Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
5-chloro-2,3-dihydro-1H-indole-2-carboxylic acid (CAS 10241-98-2) is a chemical compound with the molecular formula C9H8ClNO2 and a molecular weight of 197.62 g/mol. IUPAC name: 5-chloro-2,3-dihydro-1H-indole-2-carboxylic acid. InChIKey: FXZZXHFPSBXQKT-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO2 |
|---|---|
| Molecular weight | 197.62 g/mol |
| IUPAC name | 5-chloro-2,3-dihydro-1H-indole-2-carboxylic acid |
| InChIKey | FXZZXHFPSBXQKT-UHFFFAOYSA-N |
| SMILES | C1C(NC2=C1C=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)