CAS 102410-65-1 appears in our catalog under these names: Fmoc–Phg–OH, Fmoc-L-Phg-OH, N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-2-phenylglycine, >98.0%(HPLC)(T), Fmoc-Phg-OH 97%, FMOC-PHG-OH, >=98.0%. Offered by: GLPBio, Iris Biotech, TCI, Ambeed, Sigma-Aldrich. Available pack sizes: 25g, 5g, 100g, 1g, 10g, 500g, 100 g.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-phenylacetic acid (CAS 102410-65-1) is a chemical compound with the molecular formula C23H19NO4 and a molecular weight of 373.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-phenylacetic acid. InChIKey: PCJHOCNJLMFYCV-NRFANRHFSA-N.
| Molecular formula | C23H19NO4 |
|---|---|
| Molecular weight | 373.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-phenylacetic acid |
| InChIKey | PCJHOCNJLMFYCV-NRFANRHFSA-N |
| SMILES | C1=CC=C(C=C1)[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)