CAS 111524-95-9 appears in our catalog under these names: Fmoc–D–Phg–OH, Fmoc-D-Phg-OH, N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-D-2-phenylglycine, >97.0%(HPLC)(T), Fmoc-D-Phg-OH 98%, (R)-N-Fmoc-phenylglycine, 98%, 98%. Offered by: GLPBio, Iris Biotech, TCI, Ambeed, Chemat. Available pack sizes: 25g, 5g, 10g, 100g, 1g, 100 g.
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-phenylacetic acid (CAS 111524-95-9) is a chemical compound with the molecular formula C23H19NO4 and a molecular weight of 373.4 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-phenylacetic acid. InChIKey: PCJHOCNJLMFYCV-OAQYLSRUSA-N.
| Molecular formula | C23H19NO4 |
|---|---|
| Molecular weight | 373.4 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-phenylacetic acid |
| InChIKey | PCJHOCNJLMFYCV-OAQYLSRUSA-N |
| SMILES | C1=CC=C(C=C1)[C@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)