Products 1024114-61-1
CAS 1024114-61-1 is the registry number for 2-((2-carboxycyclopropyl)carbonylamino)benzoic acid. Offered by: Biosynth. Available pack sizes: 250mg.
2-[(2-carboxycyclopropanecarbonyl)amino]benzoic acid (CAS 1024114-61-1) is a chemical compound with the molecular formula C12H11NO5 and a molecular weight of 249.22 g/mol. IUPAC name: 2-[(2-carboxycyclopropanecarbonyl)amino]benzoic acid. InChIKey: FMBZACSQAXLFGC-UHFFFAOYSA-N.
| Molecular formula | C12H11NO5 |
|---|---|
| Molecular weight | 249.22 g/mol |
| IUPAC name | 2-[(2-carboxycyclopropanecarbonyl)amino]benzoic acid |
| InChIKey | FMBZACSQAXLFGC-UHFFFAOYSA-N |
| SMILES | C1C(C1C(=O)O)C(=O)NC2=CC=CC=C2C(=O)O |
Computed by PubChem (NCBI)