CAS 1039356-94-9 appears in our catalog under these names: Methyl 2-((tert-butoxycarbonyl)amino)-3,3,3-trifluoropropanoate, 97%, dl-N-Boc-3,3,3-Trifluoroalanine methyl ester. Offered by: AmBeed, Fluorochem. Available pack sizes: 5g, 1g.
Methyl 3,3,3-trifluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (CAS 1039356-94-9) is a chemical compound with the molecular formula C9H14F3NO4 and a molecular weight of 257.21 g/mol. IUPAC name: methyl 3,3,3-trifluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate. InChIKey: ABVSNZKOIMDOKW-UHFFFAOYSA-N.
| Molecular formula | C9H14F3NO4 |
|---|---|
| Molecular weight | 257.21 g/mol |
| IUPAC name | methyl 3,3,3-trifluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| InChIKey | ABVSNZKOIMDOKW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(C(=O)OC)C(F)(F)F |
Computed by PubChem (NCBI)