CAS 2375260-17-4 appears in our catalog under these names: (6-Oxa-2-azaspiro(3.4)octan-7-yl)methyl 2,2,2-trifluoroacetate, 98%, trifluoroacetic acid, {6-oxa-2-azaspiro[3.4]octan-7-yl}methanol, 97%, 97%, 6-oxa-2-azaspiro[3.4]octan-7-ylmethanol,2,2,2-trifluoroacetic acid, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 500mg.
6-oxa-2-azaspiro[3.4]octan-7-ylmethanol;2,2,2-trifluoroacetic acid (CAS 2375260-17-4) is a chemical compound with the molecular formula C9H14F3NO4 and a molecular weight of 257.21 g/mol. IUPAC name: 6-oxa-2-azaspiro[3.4]octan-7-ylmethanol;2,2,2-trifluoroacetic acid. InChIKey: CNIIOZXLJUKANN-UHFFFAOYSA-N.
| Molecular formula | C9H14F3NO4 |
|---|---|
| Molecular weight | 257.21 g/mol |
| IUPAC name | 6-oxa-2-azaspiro[3.4]octan-7-ylmethanol;2,2,2-trifluoroacetic acid |
| InChIKey | CNIIOZXLJUKANN-UHFFFAOYSA-N |
| SMILES | C1C(OCC12CNC2)CO.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)