CAS 51996-41-9 appears in our catalog under these names: 2,2,2-Trifluoro-N-((2S,3S,4S)-3-hydroxy-6-methoxy-2-methyltetrahydro-2H-pyran-4-yl)acetamide, 98%, Methyl N-trifluoroacetyldaunosaminide. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 25mg, 10mg, 50mg, 250mg, 100mg.
2,2,2-trifluoro-N-[(3S,6S)-3-hydroxy-6-methoxy-2-methyloxan-4-yl]acetamide (CAS 51996-41-9) is a chemical compound with the molecular formula C9H14F3NO4 and a molecular weight of 257.21 g/mol. IUPAC name: 2,2,2-trifluoro-N-[(3S,6S)-3-hydroxy-6-methoxy-2-methyloxan-4-yl]acetamide. InChIKey: QRZHBFJQGCCEPR-GOXNJFHPSA-N.
| Molecular formula | C9H14F3NO4 |
|---|---|
| Molecular weight | 257.21 g/mol |
| IUPAC name | 2,2,2-trifluoro-N-[(3S,6S)-3-hydroxy-6-methoxy-2-methyloxan-4-yl]acetamide |
| InChIKey | QRZHBFJQGCCEPR-GOXNJFHPSA-N |
| SMILES | CC1[C@H](C(C[C@H](O1)OC)NC(=O)C(F)(F)F)O |
Computed by PubChem (NCBI)