CAS 1310680-29-5 appears in our catalog under these names: (R)-Boc-3-amino-4,4,4-trifluoro-butyric acid, 95%, (R)-3-((tert-Butoxycarbonyl)amino)-4,4,4-trifluorobutanoic acid, 97%, Boc-3-amino-4,4,4-trifluoro-butyric acid (R). Offered by: Combi-blocks, AmBeed, Iris Biotech. Available pack sizes: 1g, 100mg, 250mg, 5g.
(3R)-4,4,4-trifluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 1310680-29-5) is a chemical compound with the molecular formula C9H14F3NO4 and a molecular weight of 257.21 g/mol. IUPAC name: (3R)-4,4,4-trifluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: DIEZKLWJBOJOBE-RXMQYKEDSA-N.
| Molecular formula | C9H14F3NO4 |
|---|---|
| Molecular weight | 257.21 g/mol |
| IUPAC name | (3R)-4,4,4-trifluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | DIEZKLWJBOJOBE-RXMQYKEDSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)