CAS 544479-61-0 appears in our catalog under these names: Boc-2-amino-4,4,4-trifluorobutyric acid, 95%, 2–((tert–Butoxycarbonyl)amino)–4,4,4–trifluorobutanoic acid, 2-{((tert-butoxy)carbonyl)amino}-4,4,4-trifluorobutanoic acid, Boc-DL-Abu(F3)-OH 95%, 2-((tert-Butoxycarbonyl)amino)-4,4,4-trifluorobutanoic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 100mg.
4,4,4-trifluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 544479-61-0) is a chemical compound with the molecular formula C9H14F3NO4 and a molecular weight of 257.21 g/mol. IUPAC name: 4,4,4-trifluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: UCUKFQMRNHNNQY-UHFFFAOYSA-N.
| Molecular formula | C9H14F3NO4 |
|---|---|
| Molecular weight | 257.21 g/mol |
| IUPAC name | 4,4,4-trifluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | UCUKFQMRNHNNQY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CC(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)