CAS 181128-25-6 appears in our catalog under these names: (L)-4,4,4-Trifluoro-alpha-homoalanine, N-Boc protected, 95%, Boc-L-TfAbu-OH, (S)-Boc-2-amino-4,4,4-trifluoro-butyric acid, Boc-Abu(F3)-OH 97%, (S)-2-((tert-Butoxycarbonyl)amino)-4,4,4-trifluorobutanoic acid, 98%, 98%. Offered by: Combi-blocks, Iris Biotech, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 5g, 1g, 100mg, 50mg, 10g.
(2S)-4,4,4-trifluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 181128-25-6) is a chemical compound with the molecular formula C9H14F3NO4 and a molecular weight of 257.21 g/mol. IUPAC name: (2S)-4,4,4-trifluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: UCUKFQMRNHNNQY-YFKPBYRVSA-N.
| Molecular formula | C9H14F3NO4 |
|---|---|
| Molecular weight | 257.21 g/mol |
| IUPAC name | (2S)-4,4,4-trifluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | UCUKFQMRNHNNQY-YFKPBYRVSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)