CAS 1185296-42-7 appears in our catalog under these names: 3-([(tert-Butoxy)carbonyl]amino)-4,4,4-trifluorobutanoic acid, 96%, 3-((tert-Butoxycarbonyl)amino)-4,4,4-trifluorobutanoic acid, 95+%, Boc-3-amino-4,4,4-trifluoro-butyric acid (RS), 3-{((tert-butoxy)carbonyl)amino}-4,4,4-trifluorobutanoic acid. Offered by: Combi-blocks, AmBeed, Iris Biotech, Biosynth. Available pack sizes: 250mg, 5g, 1g, 100mg, 25mg, 0,5g, 50mg.
4,4,4-trifluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 1185296-42-7) is a chemical compound with the molecular formula C9H14F3NO4 and a molecular weight of 257.21 g/mol. IUPAC name: 4,4,4-trifluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: DIEZKLWJBOJOBE-UHFFFAOYSA-N.
| Molecular formula | C9H14F3NO4 |
|---|---|
| Molecular weight | 257.21 g/mol |
| IUPAC name | 4,4,4-trifluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | DIEZKLWJBOJOBE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CC(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)