CAS 1310680-43-3 appears in our catalog under these names: Boc-3-amino-4,4,4-trifluoro-butyric acid (S), (S)-Boc-3-amino-4,4,4-trifluoro-butyric acid, 95%. Offered by: Iris Biotech, Combi-blocks. Available pack sizes: 1g, 5g, 100mg, 250mg.
(3S)-4,4,4-trifluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 1310680-43-3) is a chemical compound with the molecular formula C9H14F3NO4 and a molecular weight of 257.21 g/mol. IUPAC name: (3S)-4,4,4-trifluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: DIEZKLWJBOJOBE-YFKPBYRVSA-N.
| Molecular formula | C9H14F3NO4 |
|---|---|
| Molecular weight | 257.21 g/mol |
| IUPAC name | (3S)-4,4,4-trifluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | DIEZKLWJBOJOBE-YFKPBYRVSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)