CAS 2225878-90-8 appears in our catalog under these names: 2-(Azetidin-3-yl)-2-methylpropanoic acid tfa, 95%, 2-(azetidin-3-yl)-2-methylpropanoic acid, trifluoroacetic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
2-(azetidin-3-yl)-2-methylpropanoic acid;2,2,2-trifluoroacetic acid (CAS 2225878-90-8) is a chemical compound with the molecular formula C9H14F3NO4 and a molecular weight of 257.21 g/mol. IUPAC name: 2-(azetidin-3-yl)-2-methylpropanoic acid;2,2,2-trifluoroacetic acid. InChIKey: YHEAGWMBZMHFNR-UHFFFAOYSA-N.
| Molecular formula | C9H14F3NO4 |
|---|---|
| Molecular weight | 257.21 g/mol |
| IUPAC name | 2-(azetidin-3-yl)-2-methylpropanoic acid;2,2,2-trifluoroacetic acid |
| InChIKey | YHEAGWMBZMHFNR-UHFFFAOYSA-N |
| SMILES | CC(C)(C1CNC1)C(=O)O.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)