CAS 1367784-33-5 is the registry number for (2S,3S)-3-Methyl-2-{((2,2,2-trifluoroethoxy)carbonyl)amino}pentanoic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
(2S,3S)-3-methyl-2-(2,2,2-trifluoroethoxycarbonylamino)pentanoic acid (CAS 1367784-33-5) is a chemical compound with the molecular formula C9H14F3NO4 and a molecular weight of 257.21 g/mol. IUPAC name: (2S,3S)-3-methyl-2-(2,2,2-trifluoroethoxycarbonylamino)pentanoic acid. InChIKey: NVBQSEZINIWQIX-WDSKDSINSA-N.
| Molecular formula | C9H14F3NO4 |
|---|---|
| Molecular weight | 257.21 g/mol |
| IUPAC name | (2S,3S)-3-methyl-2-(2,2,2-trifluoroethoxycarbonylamino)pentanoic acid |
| InChIKey | NVBQSEZINIWQIX-WDSKDSINSA-N |
| SMILES | CC[C@H](C)[C@@H](C(=O)O)NC(=O)OCC(F)(F)F |
Computed by PubChem (NCBI)