CAS 104222-42-6 appears in our catalog under these names: 3-Bromo-2,4,5-trifluorobenzoic acid 98%, 3-Bromo-2,4,5-trifluorobenzoic acid, 98%. Offered by: Ambeed, Fluorochem. Available pack sizes: 1g, 5g, 25g, 10g.
3-bromo-2,4,5-trifluorobenzoic acid (CAS 104222-42-6) is a chemical compound with the molecular formula C7H2BrF3O2 and a molecular weight of 254.99 g/mol. IUPAC name: 3-bromo-2,4,5-trifluorobenzoic acid. InChIKey: VWVLSESGZBAPHA-UHFFFAOYSA-N.
| Molecular formula | C7H2BrF3O2 |
|---|---|
| Molecular weight | 254.99 g/mol |
| IUPAC name | 3-bromo-2,4,5-trifluorobenzoic acid |
| InChIKey | VWVLSESGZBAPHA-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)F)Br)F)C(=O)O |
Computed by PubChem (NCBI)