CAS 1160573-12-5 appears in our catalog under these names: 3-Bromo-2,4,6-trifluorobenzoic acid, 98%, 98%, 3-Bromo-2,4,6-trifluorobenzoic acid, ≥95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
3-bromo-2,4,6-trifluorobenzoic acid (CAS 1160573-12-5) is a chemical compound with the molecular formula C7H2BrF3O2 and a molecular weight of 254.99 g/mol. IUPAC name: 3-bromo-2,4,6-trifluorobenzoic acid. InChIKey: NLGBQBSWIXCBQZ-UHFFFAOYSA-N.
| Molecular formula | C7H2BrF3O2 |
|---|---|
| Molecular weight | 254.99 g/mol |
| IUPAC name | 3-bromo-2,4,6-trifluorobenzoic acid |
| InChIKey | NLGBQBSWIXCBQZ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)Br)F)C(=O)O)F |
Computed by PubChem (NCBI)