CAS 530145-53-0 appears in our catalog under these names: 6-Bromo-2,3,4-trifluorobenzoic acid, 95%, 6–Bromo–2,3,4–trifluorobenzoic acid, 6-Bromo-2,3,4-trifluorobenzoic acid, 98%, 98%, 6-BROMO-2,3,4-TRIFLUOROBENZOIC ACID, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 5g, 1g, 10g.
6-bromo-2,3,4-trifluorobenzoic acid (CAS 530145-53-0) is a chemical compound with the molecular formula C7H2BrF3O2 and a molecular weight of 254.99 g/mol. IUPAC name: 6-bromo-2,3,4-trifluorobenzoic acid. InChIKey: QCQROIXPDIHMBR-UHFFFAOYSA-N.
| Molecular formula | C7H2BrF3O2 |
|---|---|
| Molecular weight | 254.99 g/mol |
| IUPAC name | 6-bromo-2,3,4-trifluorobenzoic acid |
| InChIKey | QCQROIXPDIHMBR-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)C(=O)O)F)F)F |
Computed by PubChem (NCBI)