CAS 122033-62-9 is the registry number for 4-Bromo-2,3,5-trifluorobenzoic acid, 98%. Offered by: AmBeed. Available pack sizes: 1g.
4-bromo-2,3,5-trifluorobenzoic acid (CAS 122033-62-9) is a chemical compound with the molecular formula C7H2BrF3O2 and a molecular weight of 254.99 g/mol. IUPAC name: 4-bromo-2,3,5-trifluorobenzoic acid. InChIKey: HWQNWWGSYSISNO-UHFFFAOYSA-N.
| Molecular formula | C7H2BrF3O2 |
|---|---|
| Molecular weight | 254.99 g/mol |
| IUPAC name | 4-bromo-2,3,5-trifluorobenzoic acid |
| InChIKey | HWQNWWGSYSISNO-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)Br)F)F)C(=O)O |
Computed by PubChem (NCBI)