CAS 415965-35-4 appears in our catalog under these names: 4-Bromo-2,3,6-trifluorobenzoic acid, 4-Bromo-2,3,6-trifluorobenzoic acid, 95%, 4-Bromo-2,3,6-trifluorobenzoic acid, 97%, 4-bromo-2,3,6-trifluorobenzoic acid, 97%, 97%. Offered by: Biosynth, Combi-blocks, AmBeed, Fluorochem, Chemat. Available pack sizes: 250mg, 2,5g, 1g, 5g, 100mg, 500mg.
4-bromo-2,3,6-trifluorobenzoic acid (CAS 415965-35-4) is a chemical compound with the molecular formula C7H2BrF3O2 and a molecular weight of 254.99 g/mol. IUPAC name: 4-bromo-2,3,6-trifluorobenzoic acid. InChIKey: MTBBITIXENCEHJ-UHFFFAOYSA-N.
| Molecular formula | C7H2BrF3O2 |
|---|---|
| Molecular weight | 254.99 g/mol |
| IUPAC name | 4-bromo-2,3,6-trifluorobenzoic acid |
| InChIKey | MTBBITIXENCEHJ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)F)F)C(=O)O)F |
Computed by PubChem (NCBI)