Products 1628572-78-0
CAS 1628572-78-0 appears in our catalog under these names: 4-Bromo-2,2,7-trifluorobenzo[d][1,3]dioxole, 98%, 4-Bromo-2,2,7-trifluorobenzo[d][1,3]dioxole, 97%, 97%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 25g.
4-bromo-2,2,7-trifluoro-1,3-benzodioxole (CAS 1628572-78-0) is a chemical compound with the molecular formula C7H2BrF3O2 and a molecular weight of 254.99 g/mol. IUPAC name: 4-bromo-2,2,7-trifluoro-1,3-benzodioxole. InChIKey: IZJKCBBNEVWNKJ-UHFFFAOYSA-N.
| Molecular formula | C7H2BrF3O2 |
|---|---|
| Molecular weight | 254.99 g/mol |
| IUPAC name | 4-bromo-2,2,7-trifluoro-1,3-benzodioxole |
| InChIKey | IZJKCBBNEVWNKJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1F)OC(O2)(F)F)Br |
Computed by PubChem (NCBI)