CAS 212631-85-1 appears in our catalog under these names: 5-Bromo-2,3,4-trifluorobenzoic acid 97%, 5-Bromo-2,3,4-trifluorobenzoic acid, 97%, 97%, 5-Bromo-2,3,4-trifluorobenzoic acid, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g, 100g, 250mg, 10g.
5-bromo-2,3,4-trifluorobenzoic acid (CAS 212631-85-1) is a chemical compound with the molecular formula C7H2BrF3O2 and a molecular weight of 254.99 g/mol. IUPAC name: 5-bromo-2,3,4-trifluorobenzoic acid. InChIKey: XQIATTAAVBLNAN-UHFFFAOYSA-N.
| Molecular formula | C7H2BrF3O2 |
|---|---|
| Molecular weight | 254.99 g/mol |
| IUPAC name | 5-bromo-2,3,4-trifluorobenzoic acid |
| InChIKey | XQIATTAAVBLNAN-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)F)F)F)C(=O)O |
Computed by PubChem (NCBI)