CAS 1883758-68-6 is the registry number for 5-Bromo-2,2,6-trifluorobenzo[d][1,3]dioxole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-2,2,6-trifluoro-1,3-benzodioxole (CAS 1883758-68-6) is a chemical compound with the molecular formula C7H2BrF3O2 and a molecular weight of 254.99 g/mol. IUPAC name: 5-bromo-2,2,6-trifluoro-1,3-benzodioxole. InChIKey: DYTVELSWICWJFA-UHFFFAOYSA-N.
| Molecular formula | C7H2BrF3O2 |
|---|---|
| Molecular weight | 254.99 g/mol |
| IUPAC name | 5-bromo-2,2,6-trifluoro-1,3-benzodioxole |
| InChIKey | DYTVELSWICWJFA-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1F)Br)OC(O2)(F)F |
Computed by PubChem (NCBI)