CAS 1628572-74-6 is the registry number for 6-Bromo-2,2,4-trifluorobenzo(d)(1,3)dioxole, 98%. Offered by: AmBeed. Available pack sizes: 1g.
6-bromo-2,2,4-trifluoro-1,3-benzodioxole (CAS 1628572-74-6) is a chemical compound with the molecular formula C7H2BrF3O2 and a molecular weight of 254.99 g/mol. IUPAC name: 6-bromo-2,2,4-trifluoro-1,3-benzodioxole. InChIKey: ZKYMUKJYSUTQBA-UHFFFAOYSA-N.
| Molecular formula | C7H2BrF3O2 |
|---|---|
| Molecular weight | 254.99 g/mol |
| IUPAC name | 6-bromo-2,2,4-trifluoro-1,3-benzodioxole |
| InChIKey | ZKYMUKJYSUTQBA-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1OC(O2)(F)F)F)Br |
Computed by PubChem (NCBI)