CAS 118829-12-2 appears in our catalog under these names: 3-Bromo-2,5,6-trifluorobenzoic acid, 95%, 3-Bromo-2,5,6-trifluorobenzoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 10g.
3-bromo-2,5,6-trifluorobenzoic acid (CAS 118829-12-2) is a chemical compound with the molecular formula C7H2BrF3O2 and a molecular weight of 254.99 g/mol. IUPAC name: 3-bromo-2,5,6-trifluorobenzoic acid. InChIKey: IKADJZHHXKPMAH-UHFFFAOYSA-N.
| Molecular formula | C7H2BrF3O2 |
|---|---|
| Molecular weight | 254.99 g/mol |
| IUPAC name | 3-bromo-2,5,6-trifluorobenzoic acid |
| InChIKey | IKADJZHHXKPMAH-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)F)C(=O)O)F)F |
Computed by PubChem (NCBI)