CAS 1049756-13-9 appears in our catalog under these names: 2-(2,2,2-Trifluoroethoxy)phenylamine hydrochloride, 95%, 3-(2,2,2-Trifluoroethoxy)aniline hydrochloride, 95%, 95%, 3-(2,2,2-Trifluoroethoxy)aniline hydrochloride, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 1g, 5g, 10g, 25g, 100g.
3-(2,2,2-trifluoroethoxy)aniline;hydrochloride (CAS 1049756-13-9) is a chemical compound with the molecular formula C8H9ClF3NO and a molecular weight of 227.61 g/mol. IUPAC name: 3-(2,2,2-trifluoroethoxy)aniline;hydrochloride. InChIKey: RYRRTCQGCUMVCM-UHFFFAOYSA-N.
| Molecular formula | C8H9ClF3NO |
|---|---|
| Molecular weight | 227.61 g/mol |
| IUPAC name | 3-(2,2,2-trifluoroethoxy)aniline;hydrochloride |
| InChIKey | RYRRTCQGCUMVCM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OCC(F)(F)F)N.Cl |
Computed by PubChem (NCBI)