CAS 15256-07-2 appears in our catalog under these names: 1-[(Ammoniooxy)methyl]-3-(trifluoromethyl)benzene chloride, 95%, O-(3-(Trifluoromethyl)benzyl)hydroxylamine hydrochloride 95%, O-(3-(Trifluoromethyl)benzyl)hydroxylamine hydrochloride, 95%, 95%, O-[3-(Trifluoromethyl)benzyl]hydroxylamine hydrochloride, 96%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg, 25g, 10g.
O-[[3-(trifluoromethyl)phenyl]methyl]hydroxylamine;hydrochloride (CAS 15256-07-2) is a chemical compound with the molecular formula C8H9ClF3NO and a molecular weight of 227.61 g/mol. IUPAC name: O-[[3-(trifluoromethyl)phenyl]methyl]hydroxylamine;hydrochloride. InChIKey: DXEDFEUKJRKFOV-UHFFFAOYSA-N.
| Molecular formula | C8H9ClF3NO |
|---|---|
| Molecular weight | 227.61 g/mol |
| IUPAC name | O-[[3-(trifluoromethyl)phenyl]methyl]hydroxylamine;hydrochloride |
| InChIKey | DXEDFEUKJRKFOV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)CON.Cl |
Computed by PubChem (NCBI)