CAS 62740-45-8 is the registry number for 4-(2,2,2-Trifluoroethoxy)aniline hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
4-(2,2,2-trifluoroethoxy)aniline;hydrochloride (CAS 62740-45-8) is a chemical compound with the molecular formula C8H9ClF3NO and a molecular weight of 227.61 g/mol. IUPAC name: 4-(2,2,2-trifluoroethoxy)aniline;hydrochloride. InChIKey: XWHFDKIXEWONCI-UHFFFAOYSA-N.
| Molecular formula | C8H9ClF3NO |
|---|---|
| Molecular weight | 227.61 g/mol |
| IUPAC name | 4-(2,2,2-trifluoroethoxy)aniline;hydrochloride |
| InChIKey | XWHFDKIXEWONCI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N)OCC(F)(F)F.Cl |
Computed by PubChem (NCBI)