CAS 215599-92-1 appears in our catalog under these names: O-(2-(Trifluoromethyl)benzyl)hydroxylamine hydrochloride, 98%, 1-[(AMINOOXY)METHYL]-2-(TRIFLUOROMETHYL)BENZENE HYDROCHLORIDE, 98%, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 100mg, 250mg, 1g.
O-[[2-(trifluoromethyl)phenyl]methyl]hydroxylamine;hydrochloride (CAS 215599-92-1) is a chemical compound with the molecular formula C8H9ClF3NO and a molecular weight of 227.61 g/mol. IUPAC name: O-[[2-(trifluoromethyl)phenyl]methyl]hydroxylamine;hydrochloride. InChIKey: SWWNCDJXXYTTSY-UHFFFAOYSA-N.
| Molecular formula | C8H9ClF3NO |
|---|---|
| Molecular weight | 227.61 g/mol |
| IUPAC name | O-[[2-(trifluoromethyl)phenyl]methyl]hydroxylamine;hydrochloride |
| InChIKey | SWWNCDJXXYTTSY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CON)C(F)(F)F.Cl |
Computed by PubChem (NCBI)