Products 2055119-44-1
CAS 2055119-44-1 is the registry number for 2-Methyl-4-(trifluoromethoxy)benzenaminium chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
[2-methyl-4-(trifluoromethoxy)phenyl]azanium chloride (CAS 2055119-44-1) is a chemical compound with the molecular formula C8H9ClF3NO and a molecular weight of 227.61 g/mol. IUPAC name: [2-methyl-4-(trifluoromethoxy)phenyl]azanium chloride. InChIKey: ZOAWWGYFTVWYLR-UHFFFAOYSA-N.
| Molecular formula | C8H9ClF3NO |
|---|---|
| Molecular weight | 227.61 g/mol |
| IUPAC name | [2-methyl-4-(trifluoromethoxy)phenyl]azanium chloride |
| InChIKey | ZOAWWGYFTVWYLR-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)OC(F)(F)F)[NH3+].[Cl-] |
Computed by PubChem (NCBI)