Products 1215206-28-2

CAS 1215206-28-2 is the registry number for N-Methyl-4-(trifluoromethoxy)aniline hydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 25g, 5g.

Structural formula: {0} (CAS {1})

N-methyl-4-(trifluoromethoxy)aniline;hydrochloride (CAS 1215206-28-2) is a chemical compound with the molecular formula C8H9ClF3NO and a molecular weight of 227.61 g/mol. IUPAC name: N-methyl-4-(trifluoromethoxy)aniline;hydrochloride. InChIKey: HAQJOXNKLIBEQQ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H9ClF3NO
Molecular weight227.61 g/mol
IUPAC nameN-methyl-4-(trifluoromethoxy)aniline;hydrochloride
InChIKeyHAQJOXNKLIBEQQ-UHFFFAOYSA-N
SMILESCNC1=CC=C(C=C1)OC(F)(F)F.Cl

Computed by PubChem (NCBI)