CAS 1215206-28-2 is the registry number for N-Methyl-4-(trifluoromethoxy)aniline hydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 25g, 5g.
N-methyl-4-(trifluoromethoxy)aniline;hydrochloride (CAS 1215206-28-2) is a chemical compound with the molecular formula C8H9ClF3NO and a molecular weight of 227.61 g/mol. IUPAC name: N-methyl-4-(trifluoromethoxy)aniline;hydrochloride. InChIKey: HAQJOXNKLIBEQQ-UHFFFAOYSA-N.
| Molecular formula | C8H9ClF3NO |
|---|---|
| Molecular weight | 227.61 g/mol |
| IUPAC name | N-methyl-4-(trifluoromethoxy)aniline;hydrochloride |
| InChIKey | HAQJOXNKLIBEQQ-UHFFFAOYSA-N |
| SMILES | CNC1=CC=C(C=C1)OC(F)(F)F.Cl |
Computed by PubChem (NCBI)