CAS 1431964-57-6 is the registry number for 2-(2,2-Difluoroethoxy)-5-fluoroaniline hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-(2,2-difluoroethoxy)-5-fluoroaniline;hydrochloride (CAS 1431964-57-6) is a chemical compound with the molecular formula C8H9ClF3NO and a molecular weight of 227.61 g/mol. IUPAC name: 2-(2,2-difluoroethoxy)-5-fluoroaniline;hydrochloride. InChIKey: DGSQVFHHJRIBDO-UHFFFAOYSA-N.
| Molecular formula | C8H9ClF3NO |
|---|---|
| Molecular weight | 227.61 g/mol |
| IUPAC name | 2-(2,2-difluoroethoxy)-5-fluoroaniline;hydrochloride |
| InChIKey | DGSQVFHHJRIBDO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)N)OCC(F)F.Cl |
Computed by PubChem (NCBI)